C40H50O4 — CID 157493250
[(2S)-2-[4-(4-pentylcyclohexyl)benzoyl]oxy-2-phenylethyl] 4-(4-methylcyclohexyl)benzoate (PubChem CID 157493250) has the molecular formula C40H50O4 and a molecular weight of 594.84 g/mol. Its IUPAC name is [(2S)-2-[4-(4-pentylcyclohexyl)benzoyl]oxy-2-phenylethyl] 4-(4-methylcyclohexyl)benzoate.
| Compound Name | [(2S)-2-[4-(4-pentylcyclohexyl)benzoyl]oxy-2-phenylethyl] 4-(4-methylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 157493250 |
| Molecular Formula | C40H50O4 |
| Molecular Weight | 594.84 g/mol |
| Exact Mass | 594.37 |
| IUPAC Name | [(2S)-2-[4-(4-pentylcyclohexyl)benzoyl]oxy-2-phenylethyl] 4-(4-methylcyclohexyl)benzoate |
| SMILES | CCCCCC1CCC(c2ccc(C(=O)O[C@H](COC(=O)c3ccc(C4CCC(C)CC4)cc3)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C40H50O4/c1-3-4-6-9-30-14-18-32(19-15-30)34-22-26-37(27-23-34)40(42)44-38(35-10-7-5-8-11-35)28-43-39(41)36-24-20-33(21-25-36)31-16-12-29(2)13-17-31/h5,7-8,10-11,20-27,29-32,38H,3-4,6,9,12-19,28H2,1-2H3/t29?,30?,31?,32?,38-/m1/s1 |
| InChIKey | KDVSZVQULCWSJR-AACDYJBOSA-N |
| XLogP | 10.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.84 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|