C24H36F2O2 — CID 67806925
1,2-difluoroethyl 4-(4-nonylcyclohexyl)benzoate (PubChem CID 67806925) has the molecular formula C24H36F2O2 and a molecular weight of 394.55 g/mol. Its IUPAC name is 1,2-difluoroethyl 4-(4-nonylcyclohexyl)benzoate.
| Compound Name | 1,2-difluoroethyl 4-(4-nonylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 67806925 |
| Molecular Formula | C24H36F2O2 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 1,2-difluoroethyl 4-(4-nonylcyclohexyl)benzoate |
| SMILES | CCCCCCCCCC1CCC(c2ccc(C(=O)OC(F)CF)cc2)CC1 |
| InChI | InChI=1S/C24H36F2O2/c1-2-3-4-5-6-7-8-9-19-10-12-20(13-11-19)21-14-16-22(17-15-21)24(27)28-23(26)18-25/h14-17,19-20,23H,2-13,18H2,1H3 |
| InChIKey | IVCSAXXLDNGLCL-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|