C35H34F16O4 — CID 59445265
(10-benzoyloxy-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecyl) 4-(4-pentylcyclohexyl)benzoate (PubChem CID 59445265) has the molecular formula C35H34F16O4 and a molecular weight of 822.62 g/mol. Its IUPAC name is (10-benzoyloxy-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecyl) 4-(4-pentylcyclohexyl)benzoate.
| Compound Name | (10-benzoyloxy-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecyl) 4-(4-pentylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 59445265 |
| Molecular Formula | C35H34F16O4 |
| Molecular Weight | 822.62 g/mol |
| Exact Mass | 822.22 |
| IUPAC Name | (10-benzoyloxy-2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecyl) 4-(4-pentylcyclohexyl)benzoate |
| SMILES | CCCCCC1CCC(c2ccc(C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)COC(=O)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C35H34F16O4/c1-2-3-5-8-21-11-13-22(14-12-21)23-15-17-25(18-16-23)27(53)55-20-29(38,39)31(42,43)33(46,47)35(50,51)34(48,49)32(44,45)30(40,41)28(36,37)19-54-26(52)24-9-6-4-7-10-24/h4,6-7,9-10,15-18,21-22H,2-3,5,8,11-14,19-20H2,1H3 |
| InChIKey | XBYNWOCYEALCNB-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.62 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|