C41H52O3 — CID 157493251
[4-[4-(4-methylcyclohexyl)phenyl]-4-oxo-2-phenylbutyl] 4-(4-pentylcyclohexyl)benzoate (PubChem CID 157493251) has the molecular formula C41H52O3 and a molecular weight of 592.86 g/mol. Its IUPAC name is [4-[4-(4-methylcyclohexyl)phenyl]-4-oxo-2-phenylbutyl] 4-(4-pentylcyclohexyl)benzoate.
| Compound Name | [4-[4-(4-methylcyclohexyl)phenyl]-4-oxo-2-phenylbutyl] 4-(4-pentylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 157493251 |
| Molecular Formula | C41H52O3 |
| Molecular Weight | 592.86 g/mol |
| Exact Mass | 592.39 |
| IUPAC Name | [4-[4-(4-methylcyclohexyl)phenyl]-4-oxo-2-phenylbutyl] 4-(4-pentylcyclohexyl)benzoate |
| SMILES | CCCCCC1CCC(c2ccc(C(=O)OCC(CC(=O)c3ccc(C4CCC(C)CC4)cc3)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C41H52O3/c1-3-4-6-9-31-14-18-34(19-15-31)36-22-26-38(27-23-36)41(43)44-29-39(32-10-7-5-8-11-32)28-40(42)37-24-20-35(21-25-37)33-16-12-30(2)13-17-33/h5,7-8,10-11,20-27,30-31,33-34,39H,3-4,6,9,12-19,28-29H2,1-2H3 |
| InChIKey | JUSCRDQFRPNHJZ-UHFFFAOYSA-N |
| XLogP | 11.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.86 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|