C50H74O8 — CID 67826026
(2R,3R)-2,3-dimethyl-2,3-bis[[4-[4-(4-pentylcyclohexyl)butyl]benzoyl]oxy]butanedioic acid (PubChem CID 67826026) has the molecular formula C50H74O8 and a molecular weight of 803.13 g/mol. Its IUPAC name is (2R,3R)-2,3-dimethyl-2,3-bis[[4-[4-(4-pentylcyclohexyl)butyl]benzoyl]oxy]butanedioic acid.
| Compound Name | (2R,3R)-2,3-dimethyl-2,3-bis[[4-[4-(4-pentylcyclohexyl)butyl]benzoyl]oxy]butanedioic acid |
|---|---|
| PubChem CID | 67826026 |
| Molecular Formula | C50H74O8 |
| Molecular Weight | 803.13 g/mol |
| Exact Mass | 802.54 |
| IUPAC Name | (2R,3R)-2,3-dimethyl-2,3-bis[[4-[4-(4-pentylcyclohexyl)butyl]benzoyl]oxy]butanedioic acid |
| SMILES | CCCCCC1CCC(CCCCc2ccc(C(=O)O[C@@](C)(C(=O)O)[C@@](C)(OC(=O)c3ccc(CCCCC4CCC(CCCCC)CC4)cc3)C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C50H74O8/c1-5-7-9-15-37-21-25-39(26-22-37)17-11-13-19-41-29-33-43(34-30-41)45(51)57-49(3,47(53)54)50(4,48(55)56)58-46(52)44-35-31-42(32-36-44)20-14-12-18-40-27-23-38(24-28-40)16-10-8-6-2/h29-40H,5-28H2,1-4H3,(H,53,54)(H,55,56)/t37?,38?,39?,40?,49-,50-/m0/s1 |
| InChIKey | XCBHUTPERSYBJN-SRDWPJGTSA-N |
| XLogP | 12.59 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.13 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|