C48H70O10 — CID 67826011
(2R,3R)-2,3-dimethyl-2,3-bis[[4-[3-(4-pentylcyclohexyl)propoxy]benzoyl]oxy]butanedioic acid (PubChem CID 67826011) has the molecular formula C48H70O10 and a molecular weight of 807.08 g/mol. Its IUPAC name is (2R,3R)-2,3-dimethyl-2,3-bis[[4-[3-(4-pentylcyclohexyl)propoxy]benzoyl]oxy]butanedioic acid.
| Compound Name | (2R,3R)-2,3-dimethyl-2,3-bis[[4-[3-(4-pentylcyclohexyl)propoxy]benzoyl]oxy]butanedioic acid |
|---|---|
| PubChem CID | 67826011 |
| Molecular Formula | C48H70O10 |
| Molecular Weight | 807.08 g/mol |
| Exact Mass | 806.50 |
| IUPAC Name | (2R,3R)-2,3-dimethyl-2,3-bis[[4-[3-(4-pentylcyclohexyl)propoxy]benzoyl]oxy]butanedioic acid |
| SMILES | CCCCCC1CCC(CCCOc2ccc(C(=O)O[C@@](C)(C(=O)O)[C@@](C)(OC(=O)c3ccc(OCCCC4CCC(CCCCC)CC4)cc3)C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C48H70O10/c1-5-7-9-13-35-17-21-37(22-18-35)15-11-33-55-41-29-25-39(26-30-41)43(49)57-47(3,45(51)52)48(4,46(53)54)58-44(50)40-27-31-42(32-28-40)56-34-12-16-38-23-19-36(20-24-38)14-10-8-6-2/h25-32,35-38H,5-24,33-34H2,1-4H3,(H,51,52)(H,53,54)/t35?,36?,37?,38?,47-,48-/m0/s1 |
| InChIKey | QYDJRQXZFZOMHI-RGLRIHSTSA-N |
| XLogP | 11.48 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.08 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|