C18H28O — CID 114978020
(4-butylcyclohexyl)-(3-methylphenyl)methanol (PubChem CID 114978020) has the molecular formula C18H28O and a molecular weight of 260.42 g/mol. Its IUPAC name is (4-butylcyclohexyl)-(3-methylphenyl)methanol.
| Compound Name | (4-butylcyclohexyl)-(3-methylphenyl)methanol |
|---|---|
| PubChem CID | 114978020 |
| Molecular Formula | C18H28O |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | (4-butylcyclohexyl)-(3-methylphenyl)methanol |
| SMILES | CCCCC1CCC(C(O)c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C18H28O/c1-3-4-7-15-9-11-16(12-10-15)18(19)17-8-5-6-14(2)13-17/h5-6,8,13,15-16,18-19H,3-4,7,9-12H2,1-2H3 |
| InChIKey | QVIWYOXJDVEZDK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |