C15H22ClNO2 — CID 103546384
1-(3-chlorophenyl)-3-(1,3-dioxolan-2-yl)-N-propylpropan-2-amine (PubChem CID 103546384) has the molecular formula C15H22ClNO2 and a molecular weight of 283.80 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(1,3-dioxolan-2-yl)-N-propylpropan-2-amine.
| Compound Name | 1-(3-chlorophenyl)-3-(1,3-dioxolan-2-yl)-N-propylpropan-2-amine |
|---|---|
| PubChem CID | 103546384 |
| Molecular Formula | C15H22ClNO2 |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(1,3-dioxolan-2-yl)-N-propylpropan-2-amine |
| SMILES | CCCNC(Cc1cccc(Cl)c1)CC1OCCO1 |
| InChI | InChI=1S/C15H22ClNO2/c1-2-6-17-14(11-15-18-7-8-19-15)10-12-4-3-5-13(16)9-12/h3-5,9,14-15,17H,2,6-8,10-11H2,1H3 |
| InChIKey | GRCUCNSPMOBNTI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |