C14H13Cl2N3O2 — CID 103233787
4-[[2-(2,4-dichlorophenyl)ethylamino]methyl]pyrimidine-5-carboxylic acid (PubChem CID 103233787) has the molecular formula C14H13Cl2N3O2 and a molecular weight of 326.18 g/mol. Its IUPAC name is 4-[[2-(2,4-dichlorophenyl)ethylamino]methyl]pyrimidine-5-carboxylic acid.
| Compound Name | 4-[[2-(2,4-dichlorophenyl)ethylamino]methyl]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 103233787 |
| Molecular Formula | C14H13Cl2N3O2 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 4-[[2-(2,4-dichlorophenyl)ethylamino]methyl]pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cncnc1CNCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H13Cl2N3O2/c15-10-2-1-9(12(16)5-10)3-4-17-7-13-11(14(20)21)6-18-8-19-13/h1-2,5-6,8,17H,3-4,7H2,(H,20,21) |
| InChIKey | AXCAFXLNFBQLOQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|