C12H13N3O2S — CID 103235532
4-[(2-thiophen-2-ylethylamino)methyl]pyrimidine-5-carboxylic acid (PubChem CID 103235532) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is 4-[(2-thiophen-2-ylethylamino)methyl]pyrimidine-5-carboxylic acid.
| Compound Name | 4-[(2-thiophen-2-ylethylamino)methyl]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 103235532 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 4-[(2-thiophen-2-ylethylamino)methyl]pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cncnc1CNCCc1cccs1 |
| InChI | InChI=1S/C12H13N3O2S/c16-12(17)10-6-14-8-15-11(10)7-13-4-3-9-2-1-5-18-9/h1-2,5-6,8,13H,3-4,7H2,(H,16,17) |
| InChIKey | SZUHMKWDAIYRBA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|