C12H15N5O2 — CID 103263433
4-[(3-pyrazol-1-ylpropylamino)methyl]pyrimidine-5-carboxylic acid (PubChem CID 103263433) has the molecular formula C12H15N5O2 and a molecular weight of 261.28 g/mol. Its IUPAC name is 4-[(3-pyrazol-1-ylpropylamino)methyl]pyrimidine-5-carboxylic acid.
| Compound Name | 4-[(3-pyrazol-1-ylpropylamino)methyl]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 103263433 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 4-[(3-pyrazol-1-ylpropylamino)methyl]pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cncnc1CNCCCn1cccn1 |
| InChI | InChI=1S/C12H15N5O2/c18-12(19)10-7-14-9-15-11(10)8-13-3-1-5-17-6-2-4-16-17/h2,4,6-7,9,13H,1,3,5,8H2,(H,18,19) |
| InChIKey | UNZBIJBUMHGJDD-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|