C12H19N3O3 — CID 103242705
4-[(2-butoxyethylamino)methyl]pyrimidine-5-carboxylic acid (PubChem CID 103242705) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 4-[(2-butoxyethylamino)methyl]pyrimidine-5-carboxylic acid.
| Compound Name | 4-[(2-butoxyethylamino)methyl]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 103242705 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 4-[(2-butoxyethylamino)methyl]pyrimidine-5-carboxylic acid |
| SMILES | CCCCOCCNCc1ncncc1C(=O)O |
| InChI | InChI=1S/C12H19N3O3/c1-2-3-5-18-6-4-13-8-11-10(12(16)17)7-14-9-15-11/h7,9,13H,2-6,8H2,1H3,(H,16,17) |
| InChIKey | OKKYMYFQMGRJDS-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|