C12H17Cl2N3O — CID 77025238
4-[2-(2,4-dichlorophenyl)ethylamino]-N'-hydroxybutanimidamide (PubChem CID 77025238) has the molecular formula C12H17Cl2N3O and a molecular weight of 290.19 g/mol. Its IUPAC name is 4-[2-(2,4-dichlorophenyl)ethylamino]-N'-hydroxybutanimidamide.
| Compound Name | 4-[2-(2,4-dichlorophenyl)ethylamino]-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 77025238 |
| Molecular Formula | C12H17Cl2N3O |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 4-[2-(2,4-dichlorophenyl)ethylamino]-N'-hydroxybutanimidamide |
| SMILES | NC(CCCNCCc1ccc(Cl)cc1Cl)=NO |
| InChI | InChI=1S/C12H17Cl2N3O/c13-10-4-3-9(11(14)8-10)5-7-16-6-1-2-12(15)17-18/h3-4,8,16,18H,1-2,5-7H2,(H2,15,17) |
| InChIKey | PIXJZCBVBUIPAT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|