C13H16Cl2N2O — CID 82134878
3-(2,4-dichlorophenyl)-1-piperazin-1-ylpropan-1-one (PubChem CID 82134878) has the molecular formula C13H16Cl2N2O and a molecular weight of 287.19 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-piperazin-1-ylpropan-1-one.
| Compound Name | 3-(2,4-dichlorophenyl)-1-piperazin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 82134878 |
| Molecular Formula | C13H16Cl2N2O |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-piperazin-1-ylpropan-1-one |
| SMILES | O=C(CCc1ccc(Cl)cc1Cl)N1CCNCC1 |
| InChI | InChI=1S/C13H16Cl2N2O/c14-11-3-1-10(12(15)9-11)2-4-13(18)17-7-5-16-6-8-17/h1,3,9,16H,2,4-8H2 |
| InChIKey | FZEZSCVVJPHHNF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |