C17H18ClFN2O3S2 — CID 17482603
N-[1-[2-(2-chloro-6-fluorophenyl)acetyl]piperidin-4-yl]thiophene-2-sulfonamide (PubChem CID 17482603) has the molecular formula C17H18ClFN2O3S2 and a molecular weight of 416.93 g/mol. Its IUPAC name is N-[1-[2-(2-chloro-6-fluorophenyl)acetyl]piperidin-4-yl]thiophene-2-sulfonamide.
| Compound Name | N-[1-[2-(2-chloro-6-fluorophenyl)acetyl]piperidin-4-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 17482603 |
| Molecular Formula | C17H18ClFN2O3S2 |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | N-[1-[2-(2-chloro-6-fluorophenyl)acetyl]piperidin-4-yl]thiophene-2-sulfonamide |
| SMILES | O=C(Cc1c(F)cccc1Cl)N1CCC(NS(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C17H18ClFN2O3S2/c18-14-3-1-4-15(19)13(14)11-16(22)21-8-6-12(7-9-21)20-26(23,24)17-5-2-10-25-17/h1-5,10,12,20H,6-9,11H2 |
| InChIKey | SIBLERBUHWFGAO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |