C16H21ClFN3O3S — CID 37416921
2-(2-chloro-6-fluorophenyl)-1-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)ethanone (PubChem CID 37416921) has the molecular formula C16H21ClFN3O3S and a molecular weight of 389.88 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)ethanone.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 37416921 |
| Molecular Formula | C16H21ClFN3O3S |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-(4-pyrrolidin-1-ylsulfonylpiperazin-1-yl)ethanone |
| SMILES | O=C(Cc1c(F)cccc1Cl)N1CCN(S(=O)(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C16H21ClFN3O3S/c17-14-4-3-5-15(18)13(14)12-16(22)19-8-10-21(11-9-19)25(23,24)20-6-1-2-7-20/h3-5H,1-2,6-12H2 |
| InChIKey | WKSFDTCLGVCMLU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |