C18H22ClFN2O3 — CID 78785496
2-(2-chloro-6-fluorophenyl)-1-[4-(morpholine-4-carbonyl)piperidin-1-yl]ethanone (PubChem CID 78785496) has the molecular formula C18H22ClFN2O3 and a molecular weight of 368.84 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-[4-(morpholine-4-carbonyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-[4-(morpholine-4-carbonyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 78785496 |
| Molecular Formula | C18H22ClFN2O3 |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-[4-(morpholine-4-carbonyl)piperidin-1-yl]ethanone |
| SMILES | O=C(Cc1c(F)cccc1Cl)N1CCC(C(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C18H22ClFN2O3/c19-15-2-1-3-16(20)14(15)12-17(23)21-6-4-13(5-7-21)18(24)22-8-10-25-11-9-22/h1-3,13H,4-12H2 |
| InChIKey | YOMUQTHYKICUMI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |