C18H20ClN3O4S2 — CID 38171192
3-chloro-N-[2-oxo-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]ethyl]benzamide (PubChem CID 38171192) has the molecular formula C18H20ClN3O4S2 and a molecular weight of 441.96 g/mol. Its IUPAC name is 3-chloro-N-[2-oxo-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]ethyl]benzamide.
| Compound Name | 3-chloro-N-[2-oxo-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 38171192 |
| Molecular Formula | C18H20ClN3O4S2 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 3-chloro-N-[2-oxo-2-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]ethyl]benzamide |
| SMILES | O=C(NCC(=O)N1CCC(NS(=O)(=O)c2cccs2)CC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H20ClN3O4S2/c19-14-4-1-3-13(11-14)18(24)20-12-16(23)22-8-6-15(7-9-22)21-28(25,26)17-5-2-10-27-17/h1-5,10-11,15,21H,6-9,12H2,(H,20,24) |
| InChIKey | HXQJDWKAELZYOM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |