C24H20ClN3O2S — CID 68698793
N-(2-aminophenyl)-6-[1-[(4-chlorobenzoyl)amino]ethyl]-1-benzothiophene-2-carboxamide (PubChem CID 68698793) has the molecular formula C24H20ClN3O2S and a molecular weight of 449.96 g/mol. Its IUPAC name is N-(2-aminophenyl)-6-[1-[(4-chlorobenzoyl)amino]ethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-6-[1-[(4-chlorobenzoyl)amino]ethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 68698793 |
| Molecular Formula | C24H20ClN3O2S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | N-(2-aminophenyl)-6-[1-[(4-chlorobenzoyl)amino]ethyl]-1-benzothiophene-2-carboxamide |
| SMILES | CC(NC(=O)c1ccc(Cl)cc1)c1ccc2cc(C(=O)Nc3ccccc3N)sc2c1 |
| InChI | InChI=1S/C24H20ClN3O2S/c1-14(27-23(29)15-8-10-18(25)11-9-15)16-6-7-17-13-22(31-21(17)12-16)24(30)28-20-5-3-2-4-19(20)26/h2-14H,26H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | NRYXAFZYTACMCN-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|