C26H24N4OS — CID 11961249
N-(2-aminophenyl)-6-[1-(1H-indol-3-ylmethylamino)ethyl]-1-benzothiophene-2-carboxamide (PubChem CID 11961249) has the molecular formula C26H24N4OS and a molecular weight of 440.57 g/mol. Its IUPAC name is N-(2-aminophenyl)-6-[1-(1H-indol-3-ylmethylamino)ethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-6-[1-(1H-indol-3-ylmethylamino)ethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 11961249 |
| Molecular Formula | C26H24N4OS |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | N-(2-aminophenyl)-6-[1-(1H-indol-3-ylmethylamino)ethyl]-1-benzothiophene-2-carboxamide |
| SMILES | CC(NCc1c[nH]c2ccccc12)c1ccc2cc(C(=O)Nc3ccccc3N)sc2c1 |
| InChI | InChI=1S/C26H24N4OS/c1-16(28-14-19-15-29-22-8-4-2-6-20(19)22)17-10-11-18-13-25(32-24(18)12-17)26(31)30-23-9-5-3-7-21(23)27/h2-13,15-16,28-29H,14,27H2,1H3,(H,30,31) |
| InChIKey | UPXSFFVWUCWNEP-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|