C27H27N3O2 — CID 31974149
4-tert-butyl-N-[2-[[2-(1H-indol-3-yl)acetyl]amino]phenyl]benzamide (PubChem CID 31974149) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-[[2-(1H-indol-3-yl)acetyl]amino]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-[[2-(1H-indol-3-yl)acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 31974149 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 4-tert-butyl-N-[2-[[2-(1H-indol-3-yl)acetyl]amino]phenyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccccc2NC(=O)Cc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C27H27N3O2/c1-27(2,3)20-14-12-18(13-15-20)26(32)30-24-11-7-6-10-23(24)29-25(31)16-19-17-28-22-9-5-4-8-21(19)22/h4-15,17,28H,16H2,1-3H3,(H,29,31)(H,30,32) |
| InChIKey | NHPDPXPXJKQLIZ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |