C23H24N2O4 — CID 7960280
[2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate (PubChem CID 7960280) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate.
| Compound Name | [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 7960280 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | [2-[(4-tert-butylbenzoyl)amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(=O)COC(=O)Cc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C23H24N2O4/c1-23(2,3)17-10-8-15(9-11-17)22(28)25-20(26)14-29-21(27)12-16-13-24-19-7-5-4-6-18(16)19/h4-11,13,24H,12,14H2,1-3H3,(H,25,26,28) |
| InChIKey | ZPNHMWGPYBIYCR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |