C18H21N3O3 — CID 7960172
[2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate (PubChem CID 7960172) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate.
| Compound Name | [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 7960172 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | [2-[[(2S)-2-cyano-3-methylbutan-2-yl]amino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
| SMILES | CC(C)[C@@](C)(C#N)NC(=O)COC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H21N3O3/c1-12(2)18(3,11-19)21-16(22)10-24-17(23)8-13-9-20-15-7-5-4-6-14(13)15/h4-7,9,12,20H,8,10H2,1-3H3,(H,21,22)/t18-/m1/s1 |
| InChIKey | TYYZJPOHHLTEEP-GOSISDBHSA-N |
| XLogP | 2.31 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |