C35H31N5O4S — CID 68696380
benzyl N-[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]-N-[[2-[(2-aminophenyl)carbamoyl]-1-benzothiophen-6-yl]methyl]carbamate (PubChem CID 68696380) has the molecular formula C35H31N5O4S and a molecular weight of 617.73 g/mol. Its IUPAC name is benzyl N-[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]-N-[[2-[(2-aminophenyl)carbamoyl]-1-benzothiophen-6-yl]methyl]carbamate.
| Compound Name | benzyl N-[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]-N-[[2-[(2-aminophenyl)carbamoyl]-1-benzothiophen-6-yl]methyl]carbamate |
|---|---|
| PubChem CID | 68696380 |
| Molecular Formula | C35H31N5O4S |
| Molecular Weight | 617.73 g/mol |
| Exact Mass | 617.21 |
| IUPAC Name | benzyl N-[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]-N-[[2-[(2-aminophenyl)carbamoyl]-1-benzothiophen-6-yl]methyl]carbamate |
| SMILES | Nc1ccccc1NC(=O)c1cc2ccc(CN(C(=O)OCc3ccccc3)C(=O)[C@@H](N)Cc3c[nH]c4ccccc34)cc2s1 |
| InChI | InChI=1S/C35H31N5O4S/c36-27-11-5-7-13-30(27)39-33(41)32-18-24-15-14-23(16-31(24)45-32)20-40(35(43)44-21-22-8-2-1-3-9-22)34(42)28(37)17-25-19-38-29-12-6-4-10-26(25)29/h1-16,18-19,28,38H,17,20-21,36-37H2,(H,39,41)/t28-/m0/s1 |
| InChIKey | DAHOGFNVHNSJHI-NDEPHWFRSA-N |
| XLogP | 6.45 |
| TPSA | 143.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.73 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|