C13H13NO3S — CID 66115031
3-[(1-oxo-2H-isoquinolin-3-yl)sulfanyl]butanoic acid (PubChem CID 66115031) has the molecular formula C13H13NO3S and a molecular weight of 263.32 g/mol. Its IUPAC name is 3-[(1-oxo-2H-isoquinolin-3-yl)sulfanyl]butanoic acid.
| Compound Name | 3-[(1-oxo-2H-isoquinolin-3-yl)sulfanyl]butanoic acid |
|---|---|
| PubChem CID | 66115031 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 3-[(1-oxo-2H-isoquinolin-3-yl)sulfanyl]butanoic acid |
| SMILES | CC(CC(=O)O)Sc1cc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C13H13NO3S/c1-8(6-12(15)16)18-11-7-9-4-2-3-5-10(9)13(17)14-11/h2-5,7-8H,6H2,1H3,(H,14,17)(H,15,16) |
| InChIKey | XXMVLSKLCHJFMR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |