C14H16N2O4 — CID 103153725
3-methoxy-4-[(1-oxo-2H-isoquinolin-3-yl)amino]butanoic acid (PubChem CID 103153725) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 3-methoxy-4-[(1-oxo-2H-isoquinolin-3-yl)amino]butanoic acid.
| Compound Name | 3-methoxy-4-[(1-oxo-2H-isoquinolin-3-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 103153725 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 3-methoxy-4-[(1-oxo-2H-isoquinolin-3-yl)amino]butanoic acid |
| SMILES | COC(CNc1cc2ccccc2c(=O)[nH]1)CC(=O)O |
| InChI | InChI=1S/C14H16N2O4/c1-20-10(7-13(17)18)8-15-12-6-9-4-2-3-5-11(9)14(19)16-12/h2-6,10H,7-8H2,1H3,(H,17,18)(H2,15,16,19) |
| InChIKey | BEAXTRXYPOROHL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |