C10H15N3O4 — CID 136845289
3-methoxy-4-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)amino]butanoic acid (PubChem CID 136845289) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is 3-methoxy-4-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)amino]butanoic acid.
| Compound Name | 3-methoxy-4-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 136845289 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 3-methoxy-4-[(2-methyl-6-oxo-1H-pyrimidin-4-yl)amino]butanoic acid |
| SMILES | COC(CNc1cc(=O)[nH]c(C)n1)CC(=O)O |
| InChI | InChI=1S/C10H15N3O4/c1-6-12-8(4-9(14)13-6)11-5-7(17-2)3-10(15)16/h4,7H,3,5H2,1-2H3,(H,15,16)(H2,11,12,13,14) |
| InChIKey | NQFDTGCKJRIDQP-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |