C12H19N3O4 — CID 136845288
3-methoxy-4-[(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)amino]butanoic acid (PubChem CID 136845288) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is 3-methoxy-4-[(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)amino]butanoic acid.
| Compound Name | 3-methoxy-4-[(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 136845288 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3-methoxy-4-[(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)amino]butanoic acid |
| SMILES | COC(CNc1cc(=O)[nH]c(C(C)C)n1)CC(=O)O |
| InChI | InChI=1S/C12H19N3O4/c1-7(2)12-14-9(5-10(16)15-12)13-6-8(19-3)4-11(17)18/h5,7-8H,4,6H2,1-3H3,(H,17,18)(H2,13,14,15,16) |
| InChIKey | LWHULMFYYRMILS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |