C9H13N3O4 — CID 136845292
3-methoxy-4-[(6-oxo-1H-pyrimidin-4-yl)amino]butanoic acid (PubChem CID 136845292) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is 3-methoxy-4-[(6-oxo-1H-pyrimidin-4-yl)amino]butanoic acid.
| Compound Name | 3-methoxy-4-[(6-oxo-1H-pyrimidin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 136845292 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 3-methoxy-4-[(6-oxo-1H-pyrimidin-4-yl)amino]butanoic acid |
| SMILES | COC(CNc1cc(=O)[nH]cn1)CC(=O)O |
| InChI | InChI=1S/C9H13N3O4/c1-16-6(2-9(14)15)4-10-7-3-8(13)12-5-11-7/h3,5-6H,2,4H2,1H3,(H,14,15)(H2,10,11,12,13) |
| InChIKey | PLWCDMYTAFQCRQ-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |