C13H17N3O4 — CID 136959217
2-[4-(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)morpholin-2-yl]acetic acid (PubChem CID 136959217) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-[4-(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 136959217 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 2-[4-(2-cyclopropyl-6-oxo-1H-pyrimidin-4-yl)morpholin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CN(c2cc(=O)[nH]c(C3CC3)n2)CCO1 |
| InChI | InChI=1S/C13H17N3O4/c17-11-6-10(14-13(15-11)8-1-2-8)16-3-4-20-9(7-16)5-12(18)19/h6,8-9H,1-5,7H2,(H,18,19)(H,14,15,17) |
| InChIKey | NUGVIGFUPAGYFA-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |