C9H6ClFN2O — CID 175458349
4-chloro-6-fluoro-1H-indole-2-carboxamide (PubChem CID 175458349) has the molecular formula C9H6ClFN2O and a molecular weight of 212.61 g/mol. Its IUPAC name is 4-chloro-6-fluoro-1H-indole-2-carboxamide.
| Compound Name | 4-chloro-6-fluoro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 175458349 |
| Molecular Formula | C9H6ClFN2O |
| Molecular Weight | 212.61 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 4-chloro-6-fluoro-1H-indole-2-carboxamide |
| SMILES | NC(=O)c1cc2c(Cl)cc(F)cc2[nH]1 |
| InChI | InChI=1S/C9H6ClFN2O/c10-6-1-4(11)2-7-5(6)3-8(13-7)9(12)14/h1-3,13H,(H2,12,14) |
| InChIKey | GJEKQDIEWDILGV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.61 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |