C16H18BrFN2O2 — CID 136547926
(6-bromo-4-fluoro-1H-indol-2-yl)-[3-(hydroxymethyl)-2-methylpiperidin-1-yl]methanone (PubChem CID 136547926) has the molecular formula C16H18BrFN2O2 and a molecular weight of 369.23 g/mol. Its IUPAC name is (6-bromo-4-fluoro-1H-indol-2-yl)-[3-(hydroxymethyl)-2-methylpiperidin-1-yl]methanone.
| Compound Name | (6-bromo-4-fluoro-1H-indol-2-yl)-[3-(hydroxymethyl)-2-methylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 136547926 |
| Molecular Formula | C16H18BrFN2O2 |
| Molecular Weight | 369.23 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | (6-bromo-4-fluoro-1H-indol-2-yl)-[3-(hydroxymethyl)-2-methylpiperidin-1-yl]methanone |
| SMILES | CC1C(CO)CCCN1C(=O)c1cc2c(F)cc(Br)cc2[nH]1 |
| InChI | InChI=1S/C16H18BrFN2O2/c1-9-10(8-21)3-2-4-20(9)16(22)15-7-12-13(18)5-11(17)6-14(12)19-15/h5-7,9-10,19,21H,2-4,8H2,1H3 |
| InChIKey | LDFSKFOJLGRKHU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.23 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |