C14H15FN2O2 — CID 99698506
(5-fluoro-1H-indol-2-yl)-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone (PubChem CID 99698506) has the molecular formula C14H15FN2O2 and a molecular weight of 262.28 g/mol. Its IUPAC name is (5-fluoro-1H-indol-2-yl)-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (5-fluoro-1H-indol-2-yl)-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 99698506 |
| Molecular Formula | C14H15FN2O2 |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (5-fluoro-1H-indol-2-yl)-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cc2cc(F)ccc2[nH]1)N1CCC[C@@H]1CO |
| InChI | InChI=1S/C14H15FN2O2/c15-10-3-4-12-9(6-10)7-13(16-12)14(19)17-5-1-2-11(17)8-18/h3-4,6-7,11,16,18H,1-2,5,8H2/t11-/m1/s1 |
| InChIKey | BGBIPEJVZFTYSG-LLVKDONJSA-N |
| XLogP | 1.90 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |