C17H16F2N2O3 — CID 175447390
2-(4,6-difluoro-1H-indole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid (PubChem CID 175447390) has the molecular formula C17H16F2N2O3 and a molecular weight of 334.32 g/mol. Its IUPAC name is 2-(4,6-difluoro-1H-indole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid.
| Compound Name | 2-(4,6-difluoro-1H-indole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 175447390 |
| Molecular Formula | C17H16F2N2O3 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-(4,6-difluoro-1H-indole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
| SMILES | O=C(O)C1C2CCCC2CN1C(=O)c1cc2c(F)cc(F)cc2[nH]1 |
| InChI | InChI=1S/C17H16F2N2O3/c18-9-4-12(19)11-6-14(20-13(11)5-9)16(22)21-7-8-2-1-3-10(8)15(21)17(23)24/h4-6,8,10,15,20H,1-3,7H2,(H,23,24) |
| InChIKey | KMZXMDYNMJAQIK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |