C19H18BrFN2O3 — CID 139002452
(6-bromo-4-fluoro-1H-indol-2-yl)-[3-(5-ethylfuran-2-yl)morpholin-4-yl]methanone (PubChem CID 139002452) has the molecular formula C19H18BrFN2O3 and a molecular weight of 421.27 g/mol. Its IUPAC name is (6-bromo-4-fluoro-1H-indol-2-yl)-[3-(5-ethylfuran-2-yl)morpholin-4-yl]methanone.
| Compound Name | (6-bromo-4-fluoro-1H-indol-2-yl)-[3-(5-ethylfuran-2-yl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 139002452 |
| Molecular Formula | C19H18BrFN2O3 |
| Molecular Weight | 421.27 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | (6-bromo-4-fluoro-1H-indol-2-yl)-[3-(5-ethylfuran-2-yl)morpholin-4-yl]methanone |
| SMILES | CCc1ccc(C2COCCN2C(=O)c2cc3c(F)cc(Br)cc3[nH]2)o1 |
| InChI | InChI=1S/C19H18BrFN2O3/c1-2-12-3-4-18(26-12)17-10-25-6-5-23(17)19(24)16-9-13-14(21)7-11(20)8-15(13)22-16/h3-4,7-9,17,22H,2,5-6,10H2,1H3 |
| InChIKey | YKXROWLBBPYFCZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 58.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.27 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |