C22H30N2O3 — CID 102557628
[4-(diethylaminomethyl)phenyl]-[3-(5-ethylfuran-2-yl)morpholin-4-yl]methanone (PubChem CID 102557628) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is [4-(diethylaminomethyl)phenyl]-[3-(5-ethylfuran-2-yl)morpholin-4-yl]methanone.
| Compound Name | [4-(diethylaminomethyl)phenyl]-[3-(5-ethylfuran-2-yl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 102557628 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | [4-(diethylaminomethyl)phenyl]-[3-(5-ethylfuran-2-yl)morpholin-4-yl]methanone |
| SMILES | CCc1ccc(C2COCCN2C(=O)c2ccc(CN(CC)CC)cc2)o1 |
| InChI | InChI=1S/C22H30N2O3/c1-4-19-11-12-21(27-19)20-16-26-14-13-24(20)22(25)18-9-7-17(8-10-18)15-23(5-2)6-3/h7-12,20H,4-6,13-16H2,1-3H3 |
| InChIKey | QIMIGXYNLSWYSH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |