C20H25NO4 — CID 110025457
1-[3-(5-ethylfuran-2-yl)morpholin-4-yl]-3-hydroxy-3-phenylbutan-1-one (PubChem CID 110025457) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is 1-[3-(5-ethylfuran-2-yl)morpholin-4-yl]-3-hydroxy-3-phenylbutan-1-one.
| Compound Name | 1-[3-(5-ethylfuran-2-yl)morpholin-4-yl]-3-hydroxy-3-phenylbutan-1-one |
|---|---|
| PubChem CID | 110025457 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 1-[3-(5-ethylfuran-2-yl)morpholin-4-yl]-3-hydroxy-3-phenylbutan-1-one |
| SMILES | CCc1ccc(C2COCCN2C(=O)CC(C)(O)c2ccccc2)o1 |
| InChI | InChI=1S/C20H25NO4/c1-3-16-9-10-18(25-16)17-14-24-12-11-21(17)19(22)13-20(2,23)15-7-5-4-6-8-15/h4-10,17,23H,3,11-14H2,1-2H3 |
| InChIKey | BSBFFRLMYGXLDN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |