C18H30N2O4 — CID 96519217
(3S)-3-(5-ethylfuran-2-yl)-N-[(2S)-4-methoxy-4-methylpentan-2-yl]morpholine-4-carboxamide (PubChem CID 96519217) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is (3S)-3-(5-ethylfuran-2-yl)-N-[(2S)-4-methoxy-4-methylpentan-2-yl]morpholine-4-carboxamide.
| Compound Name | (3S)-3-(5-ethylfuran-2-yl)-N-[(2S)-4-methoxy-4-methylpentan-2-yl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 96519217 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | (3S)-3-(5-ethylfuran-2-yl)-N-[(2S)-4-methoxy-4-methylpentan-2-yl]morpholine-4-carboxamide |
| SMILES | CCc1ccc([C@@H]2COCCN2C(=O)N[C@@H](C)CC(C)(C)OC)o1 |
| InChI | InChI=1S/C18H30N2O4/c1-6-14-7-8-16(24-14)15-12-23-10-9-20(15)17(21)19-13(2)11-18(3,4)22-5/h7-8,13,15H,6,9-12H2,1-5H3,(H,19,21)/t13-,15-/m0/s1 |
| InChIKey | PZVDMJWJMCIAJW-ZFWWWQNUSA-N |
| XLogP | 3.13 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |