C18H17BrFN5O2 — CID 86958830
(6-bromo-4-fluoro-1H-indol-2-yl)-[4-(6-methoxypyrazin-2-yl)piperazin-1-yl]methanone (PubChem CID 86958830) has the molecular formula C18H17BrFN5O2 and a molecular weight of 434.27 g/mol. Its IUPAC name is (6-bromo-4-fluoro-1H-indol-2-yl)-[4-(6-methoxypyrazin-2-yl)piperazin-1-yl]methanone.
| Compound Name | (6-bromo-4-fluoro-1H-indol-2-yl)-[4-(6-methoxypyrazin-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 86958830 |
| Molecular Formula | C18H17BrFN5O2 |
| Molecular Weight | 434.27 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | (6-bromo-4-fluoro-1H-indol-2-yl)-[4-(6-methoxypyrazin-2-yl)piperazin-1-yl]methanone |
| SMILES | COc1cncc(N2CCN(C(=O)c3cc4c(F)cc(Br)cc4[nH]3)CC2)n1 |
| InChI | InChI=1S/C18H17BrFN5O2/c1-27-17-10-21-9-16(23-17)24-2-4-25(5-3-24)18(26)15-8-12-13(20)6-11(19)7-14(12)22-15/h6-10,22H,2-5H2,1H3 |
| InChIKey | AOCFZCRKAXXZDZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |