C19H18F3N5O3 — CID 86958970
[4-(6-methoxypyrazin-2-yl)piperazin-1-yl]-[6-(trifluoromethoxy)-1H-indol-2-yl]methanone (PubChem CID 86958970) has the molecular formula C19H18F3N5O3 and a molecular weight of 421.38 g/mol. Its IUPAC name is [4-(6-methoxypyrazin-2-yl)piperazin-1-yl]-[6-(trifluoromethoxy)-1H-indol-2-yl]methanone.
| Compound Name | [4-(6-methoxypyrazin-2-yl)piperazin-1-yl]-[6-(trifluoromethoxy)-1H-indol-2-yl]methanone |
|---|---|
| PubChem CID | 86958970 |
| Molecular Formula | C19H18F3N5O3 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | [4-(6-methoxypyrazin-2-yl)piperazin-1-yl]-[6-(trifluoromethoxy)-1H-indol-2-yl]methanone |
| SMILES | COc1cncc(N2CCN(C(=O)c3cc4ccc(OC(F)(F)F)cc4[nH]3)CC2)n1 |
| InChI | InChI=1S/C19H18F3N5O3/c1-29-17-11-23-10-16(25-17)26-4-6-27(7-5-26)18(28)15-8-12-2-3-13(9-14(12)24-15)30-19(20,21)22/h2-3,8-11,24H,4-7H2,1H3 |
| InChIKey | UOHZTFKZAMRVHG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |