C20H23F3N2O4 — CID 99809959
[4-(oxan-4-yloxy)piperidin-1-yl]-[6-(trifluoromethoxy)-1H-indol-2-yl]methanone (PubChem CID 99809959) has the molecular formula C20H23F3N2O4 and a molecular weight of 412.41 g/mol. Its IUPAC name is [4-(oxan-4-yloxy)piperidin-1-yl]-[6-(trifluoromethoxy)-1H-indol-2-yl]methanone.
| Compound Name | [4-(oxan-4-yloxy)piperidin-1-yl]-[6-(trifluoromethoxy)-1H-indol-2-yl]methanone |
|---|---|
| PubChem CID | 99809959 |
| Molecular Formula | C20H23F3N2O4 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | [4-(oxan-4-yloxy)piperidin-1-yl]-[6-(trifluoromethoxy)-1H-indol-2-yl]methanone |
| SMILES | O=C(c1cc2ccc(OC(F)(F)F)cc2[nH]1)N1CCC(OC2CCOCC2)CC1 |
| InChI | InChI=1S/C20H23F3N2O4/c21-20(22,23)29-16-2-1-13-11-18(24-17(13)12-16)19(26)25-7-3-14(4-8-25)28-15-5-9-27-10-6-15/h1-2,11-12,14-15,24H,3-10H2 |
| InChIKey | XCILCIZUFBCSNM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |