C18H18F3N3O3 — CID 166424560
N-[(3R)-1-[6-(trifluoromethoxy)-1H-indole-2-carbonyl]piperidin-3-yl]prop-2-enamide (PubChem CID 166424560) has the molecular formula C18H18F3N3O3 and a molecular weight of 381.35 g/mol. Its IUPAC name is N-[(3R)-1-[6-(trifluoromethoxy)-1H-indole-2-carbonyl]piperidin-3-yl]prop-2-enamide.
| Compound Name | N-[(3R)-1-[6-(trifluoromethoxy)-1H-indole-2-carbonyl]piperidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 166424560 |
| Molecular Formula | C18H18F3N3O3 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | N-[(3R)-1-[6-(trifluoromethoxy)-1H-indole-2-carbonyl]piperidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1CCCN(C(=O)c2cc3ccc(OC(F)(F)F)cc3[nH]2)C1 |
| InChI | InChI=1S/C18H18F3N3O3/c1-2-16(25)22-12-4-3-7-24(10-12)17(26)15-8-11-5-6-13(9-14(11)23-15)27-18(19,20)21/h2,5-6,8-9,12,23H,1,3-4,7,10H2,(H,22,25)/t12-/m1/s1 |
| InChIKey | OXQSICQQDKYAET-GFCCVEGCSA-N |
| XLogP | 2.97 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|