C25H21F3N6O6 — CID 163598708
2H-benzotriazol-5-yl-[(1S,2S,6S,8S)-10-[6-(trifluoromethoxy)-1H-indole-2-carbonyl]-7,12,13-trioxa-4,10-diazatricyclo[6.3.1.12,6]tridecan-4-yl]methanone (PubChem CID 163598708) has the molecular formula C25H21F3N6O6 and a molecular weight of 558.47 g/mol. Its IUPAC name is 2H-benzotriazol-5-yl-[(1S,2S,6S,8S)-10-[6-(trifluoromethoxy)-1H-indole-2-carbonyl]-7,12,13-trioxa-4,10-diazatricyclo[6.3.1.12,6]tridecan-4-yl]methanone.
| Compound Name | 2H-benzotriazol-5-yl-[(1S,2S,6S,8S)-10-[6-(trifluoromethoxy)-1H-indole-2-carbonyl]-7,12,13-trioxa-4,10-diazatricyclo[6.3.1.12,6]tridecan-4-yl]methanone |
|---|---|
| PubChem CID | 163598708 |
| Molecular Formula | C25H21F3N6O6 |
| Molecular Weight | 558.47 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | 2H-benzotriazol-5-yl-[(1S,2S,6S,8S)-10-[6-(trifluoromethoxy)-1H-indole-2-carbonyl]-7,12,13-trioxa-4,10-diazatricyclo[6.3.1.12,6]tridecan-4-yl]methanone |
| SMILES | O=C(c1ccc2n[nH]nc2c1)N1C[C@@H]2O[C@H]3CN(C(=O)c4cc5ccc(OC(F)(F)F)cc5[nH]4)C[C@H](O3)[C@H](C1)O2 |
| InChI | InChI=1S/C25H21F3N6O6/c26-25(27,28)40-14-3-1-12-5-18(29-16(12)7-14)24(36)34-9-20-19-8-33(10-21(37-19)39-22(11-34)38-20)23(35)13-2-4-15-17(6-13)31-32-30-15/h1-7,19-22,29H,8-11H2,(H,30,31,32)/t19-,20-,21-,22-/m0/s1 |
| InChIKey | GVTAGHFHXCSKBJ-CMOCDZPBSA-N |
| XLogP | 2.40 |
| TPSA | 134.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |