C19H22BrNO4 — CID 66968171
tert-butyl 2-(5-bromo-1-benzofuran-2-carbonyl)piperidine-1-carboxylate (PubChem CID 66968171) has the molecular formula C19H22BrNO4 and a molecular weight of 408.29 g/mol. Its IUPAC name is tert-butyl 2-(5-bromo-1-benzofuran-2-carbonyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-(5-bromo-1-benzofuran-2-carbonyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66968171 |
| Molecular Formula | C19H22BrNO4 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | tert-butyl 2-(5-bromo-1-benzofuran-2-carbonyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1C(=O)c1cc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C19H22BrNO4/c1-19(2,3)25-18(23)21-9-5-4-6-14(21)17(22)16-11-12-10-13(20)7-8-15(12)24-16/h7-8,10-11,14H,4-6,9H2,1-3H3 |
| InChIKey | VKIOPDGUMAMNNI-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |