C21H20BrNO3 — CID 97014745
(5-bromo-1-benzofuran-2-yl)-[4-[(R)-hydroxy(phenyl)methyl]piperidin-1-yl]methanone (PubChem CID 97014745) has the molecular formula C21H20BrNO3 and a molecular weight of 414.30 g/mol. Its IUPAC name is (5-bromo-1-benzofuran-2-yl)-[4-[(R)-hydroxy(phenyl)methyl]piperidin-1-yl]methanone.
| Compound Name | (5-bromo-1-benzofuran-2-yl)-[4-[(R)-hydroxy(phenyl)methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 97014745 |
| Molecular Formula | C21H20BrNO3 |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | (5-bromo-1-benzofuran-2-yl)-[4-[(R)-hydroxy(phenyl)methyl]piperidin-1-yl]methanone |
| SMILES | O=C(c1cc2cc(Br)ccc2o1)N1CCC([C@@H](O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H20BrNO3/c22-17-6-7-18-16(12-17)13-19(26-18)21(25)23-10-8-15(9-11-23)20(24)14-4-2-1-3-5-14/h1-7,12-13,15,20,24H,8-11H2/t20-/m0/s1 |
| InChIKey | SSVYPKATBAAXAS-FQEVSTJZSA-N |
| XLogP | 4.78 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |