C18H17BrN2O4S2 — CID 46450714
N-[1-(5-bromo-1-benzofuran-2-carbonyl)piperidin-4-yl]thiophene-2-sulfonamide (PubChem CID 46450714) has the molecular formula C18H17BrN2O4S2 and a molecular weight of 469.38 g/mol. Its IUPAC name is N-[1-(5-bromo-1-benzofuran-2-carbonyl)piperidin-4-yl]thiophene-2-sulfonamide.
| Compound Name | N-[1-(5-bromo-1-benzofuran-2-carbonyl)piperidin-4-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 46450714 |
| Molecular Formula | C18H17BrN2O4S2 |
| Molecular Weight | 469.38 g/mol |
| Exact Mass | 467.98 |
| IUPAC Name | N-[1-(5-bromo-1-benzofuran-2-carbonyl)piperidin-4-yl]thiophene-2-sulfonamide |
| SMILES | O=C(c1cc2cc(Br)ccc2o1)N1CCC(NS(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C18H17BrN2O4S2/c19-13-3-4-15-12(10-13)11-16(25-15)18(22)21-7-5-14(6-8-21)20-27(23,24)17-2-1-9-26-17/h1-4,9-11,14,20H,5-8H2 |
| InChIKey | OOLUDFKYGOOBMT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |