C17H16N4O3S4 — CID 38174130
N-[1-(5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carbonyl)piperidin-4-yl]thiophene-2-sulfonamide (PubChem CID 38174130) has the molecular formula C17H16N4O3S4 and a molecular weight of 452.61 g/mol. Its IUPAC name is N-[1-(5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carbonyl)piperidin-4-yl]thiophene-2-sulfonamide.
| Compound Name | N-[1-(5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carbonyl)piperidin-4-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 38174130 |
| Molecular Formula | C17H16N4O3S4 |
| Molecular Weight | 452.61 g/mol |
| Exact Mass | 452.01 |
| IUPAC Name | N-[1-(5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carbonyl)piperidin-4-yl]thiophene-2-sulfonamide |
| SMILES | O=C(c1cc2c(nc3sccn32)s1)N1CCC(NS(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C17H16N4O3S4/c22-16(13-10-12-15(27-13)18-17-21(12)7-9-26-17)20-5-3-11(4-6-20)19-28(23,24)14-2-1-8-25-14/h1-2,7-11,19H,3-6H2 |
| InChIKey | BQLOHUXQOUBMPJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.61 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |