C20H15F3N4O2S2 — CID 46423195
[4-(5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carbonyl)piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone (PubChem CID 46423195) has the molecular formula C20H15F3N4O2S2 and a molecular weight of 464.49 g/mol. Its IUPAC name is [4-(5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carbonyl)piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-(5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carbonyl)piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 46423195 |
| Molecular Formula | C20H15F3N4O2S2 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | [4-(5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carbonyl)piperazin-1-yl]-[4-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)cc1)N1CCN(C(=O)c2cc3c(nc4sccn43)s2)CC1 |
| InChI | InChI=1S/C20H15F3N4O2S2/c21-20(22,23)13-3-1-12(2-4-13)17(28)25-5-7-26(8-6-25)18(29)15-11-14-16(31-15)24-19-27(14)9-10-30-19/h1-4,9-11H,5-8H2 |
| InChIKey | JWSUKAMVIQVKQV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |