C13H13N3O2S2 — CID 83190261
N-cyclopentyloxy-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide (PubChem CID 83190261) has the molecular formula C13H13N3O2S2 and a molecular weight of 307.40 g/mol. Its IUPAC name is N-cyclopentyloxy-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide.
| Compound Name | N-cyclopentyloxy-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 83190261 |
| Molecular Formula | C13H13N3O2S2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | N-cyclopentyloxy-5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxamide |
| SMILES | O=C(NOC1CCCC1)c1cc2c(nc3sccn32)s1 |
| InChI | InChI=1S/C13H13N3O2S2/c17-11(15-18-8-3-1-2-4-8)10-7-9-12(20-10)14-13-16(9)5-6-19-13/h5-8H,1-4H2,(H,15,17) |
| InChIKey | XTURYFGUPMHBPX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|