C8H3N2O2S2- — CID 7063408
5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxylate (PubChem CID 7063408) has the molecular formula C8H3N2O2S2- and a molecular weight of 223.26 g/mol. Its IUPAC name is 5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxylate.
| Compound Name | 5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 7063408 |
| Molecular Formula | C8H3N2O2S2- |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 222.96 |
| IUPAC Name | 5,9-dithia-1,7-diazatricyclo[6.3.0.02,6]undeca-2(6),3,7,10-tetraene-4-carboxylate |
| SMILES | O=C([O-])c1cc2c(nc3sccn32)s1 |
| InChI | InChI=1S/C8H4N2O2S2/c11-7(12)5-3-4-6(14-5)9-8-10(4)1-2-13-8/h1-3H,(H,11,12)/p-1 |
| InChIKey | YVAYRVRJROAHIC-UHFFFAOYSA-M |
| XLogP | 0.97 |
| TPSA | 57.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |